C11H13NO2 — CID 139724595
4-(1,2,3,6-tetrahydropyridin-4-yl)benzene-1,3-diol (PubChem CID 139724595) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-(1,2,3,6-tetrahydropyridin-4-yl)benzene-1,3-diol.
| Compound Name | 4-(1,2,3,6-tetrahydropyridin-4-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 139724595 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 4-(1,2,3,6-tetrahydropyridin-4-yl)benzene-1,3-diol |
| SMILES | Oc1ccc(C2=CCNCC2)c(O)c1 |
| InChI | InChI=1S/C11H13NO2/c13-9-1-2-10(11(14)7-9)8-3-5-12-6-4-8/h1-3,7,12-14H,4-6H2 |
| InChIKey | JIEZHGTZAWIQOD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |