C21H23NO2 — CID 139724947
1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol (PubChem CID 139724947) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol.
| Compound Name | 1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 139724947 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol |
| SMILES | OC1(c2ccccc2C2=N[C@H](c3ccccc3)CO2)CCCCC1 |
| InChI | InChI=1S/C21H23NO2/c23-21(13-7-2-8-14-21)18-12-6-5-11-17(18)20-22-19(15-24-20)16-9-3-1-4-10-16/h1,3-6,9-12,19,23H,2,7-8,13-15H2/t19-/m0/s1 |
| InChIKey | UTNGJRQKLSFBHZ-IBGZPJMESA-N |
| XLogP | 4.36 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |