About 1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol
1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol (PubChem CID 139724947) has the molecular formula C21H23NO2
and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol |
| PubChem CID | 139724947 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol |
| SMILES | OC1(c2ccccc2C2=N[C@H](c3ccccc3)CO2)CCCCC1 |
| InChI | InChI=1S/C21H23NO2/c23-21(13-7-2-8-14-21)18-12-6-5-11-17(18)20-22-19(15-24-20)16-9-3-1-4-10-16/h1,3-6,9-12,19,23H,2,7-8,13-15H2/t19-/m0/s1 |
| InChIKey | UTNGJRQKLSFBHZ-IBGZPJMESA-N |
| XLogP | 4.36 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol?
The IUPAC name of 1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol (CID 139724947) is 1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol.
What is the SMILES notation for 1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol?
The canonical SMILES for 1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol is OC1(c2ccccc2C2=N[C@H](c3ccccc3)CO2)CCCCC1.
What is the InChIKey of 1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol?
The InChIKey is UTNGJRQKLSFBHZ-IBGZPJMESA-N. The full InChI is InChI=1S/C21H23NO2/c23-21(13-7-2-8-14-21)18-12-6-5-11-17(18)20-22-19(15-24-20)16-9-3-1-4-10-16/h1,3-6,9-12,19,23H,2,7-8,13-15H2/t19-/m0/s1.
What are the key properties of 1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol?
1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol has a molecular weight of 321.42 g/mol, XLogP of 4.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]cyclohexan-1-ol is sourced from PubChem (CID 139724947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).