C22H24N10 — CID 139725579
N,N,N',N'-tetrakis(pyrimidin-2-ylmethyl)ethane-1,2-diamine (PubChem CID 139725579) has the molecular formula C22H24N10 and a molecular weight of 428.50 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(pyrimidin-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N,N,N',N'-tetrakis(pyrimidin-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 139725579 |
| Molecular Formula | C22H24N10 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N,N,N',N'-tetrakis(pyrimidin-2-ylmethyl)ethane-1,2-diamine |
| SMILES | c1cnc(CN(CCN(Cc2ncccn2)Cc2ncccn2)Cc2ncccn2)nc1 |
| InChI | InChI=1S/C22H24N10/c1-5-23-19(24-6-1)15-31(16-20-25-7-2-8-26-20)13-14-32(17-21-27-9-3-10-28-21)18-22-29-11-4-12-30-22/h1-12H,13-18H2 |
| InChIKey | FIRVUHZFGDXZSW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 109.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |