C12H12N2O5 — CID 139726262
4'-(5-methyl-1,3-oxazol-2-yl)spiro[1,3-dioxolane-2,2'-1-azabicyclo[2.2.1]heptane]-4,5-dione (PubChem CID 139726262) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is 4'-(5-methyl-1,3-oxazol-2-yl)spiro[1,3-dioxolane-2,2'-1-azabicyclo[2.2.1]heptane]-4,5-dione.
| Compound Name | 4'-(5-methyl-1,3-oxazol-2-yl)spiro[1,3-dioxolane-2,2'-1-azabicyclo[2.2.1]heptane]-4,5-dione |
|---|---|
| PubChem CID | 139726262 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 4'-(5-methyl-1,3-oxazol-2-yl)spiro[1,3-dioxolane-2,2'-1-azabicyclo[2.2.1]heptane]-4,5-dione |
| SMILES | Cc1cnc(C23CCN(C2)C2(C3)OC(=O)C(=O)O2)o1 |
| InChI | InChI=1S/C12H12N2O5/c1-7-4-13-10(17-7)11-2-3-14(6-11)12(5-11)18-8(15)9(16)19-12/h4H,2-3,5-6H2,1H3 |
| InChIKey | PCOPMIDLEKYYSY-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|