About tris(4-ethoxybutyl) arsorite
tris(4-ethoxybutyl) arsorite (PubChem CID 139727024) has the molecular formula C18H39AsO6
and a molecular weight of 426.43 g/mol. Its IUPAC name is tris(4-ethoxybutyl) arsorite.
Molecular Properties
| Compound Name | tris(4-ethoxybutyl) arsorite |
| PubChem CID | 139727024 |
| Molecular Formula | C18H39AsO6 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | tris(4-ethoxybutyl) arsorite |
| SMILES | CCOCCCCO[As](OCCCCOCC)OCCCCOCC |
| InChI | InChI=1S/C18H39AsO6/c1-4-20-13-7-10-16-23-19(24-17-11-8-14-21-5-2)25-18-12-9-15-22-6-3/h4-18H2,1-3H3 |
| InChIKey | FCGVJNQGTMZNSN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tris(4-ethoxybutyl) arsorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(4-ethoxybutyl) arsorite?
The IUPAC name of tris(4-ethoxybutyl) arsorite (CID 139727024) is tris(4-ethoxybutyl) arsorite.
What is the SMILES notation for tris(4-ethoxybutyl) arsorite?
The canonical SMILES for tris(4-ethoxybutyl) arsorite is CCOCCCCO[As](OCCCCOCC)OCCCCOCC.
What is the InChIKey of tris(4-ethoxybutyl) arsorite?
The InChIKey is FCGVJNQGTMZNSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39AsO6/c1-4-20-13-7-10-16-23-19(24-17-11-8-14-21-5-2)25-18-12-9-15-22-6-3/h4-18H2,1-3H3.
What are the key properties of tris(4-ethoxybutyl) arsorite?
tris(4-ethoxybutyl) arsorite has a molecular weight of 426.43 g/mol, XLogP of 3.47, 21 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tris(4-ethoxybutyl) arsorite is sourced from PubChem (CID 139727024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).