C12H21AsO9 — CID 139727059
3-[bis(2-carboxypropoxy)arsanyloxy]-2-methylpropanoic acid (PubChem CID 139727059) has the molecular formula C12H21AsO9 and a molecular weight of 384.21 g/mol. Its IUPAC name is 3-[bis(2-carboxypropoxy)arsanyloxy]-2-methylpropanoic acid.
| Compound Name | 3-[bis(2-carboxypropoxy)arsanyloxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 139727059 |
| Molecular Formula | C12H21AsO9 |
| Molecular Weight | 384.21 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 3-[bis(2-carboxypropoxy)arsanyloxy]-2-methylpropanoic acid |
| SMILES | CC(CO[As](OCC(C)C(=O)O)OCC(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H21AsO9/c1-7(10(14)15)4-20-13(21-5-8(2)11(16)17)22-6-9(3)12(18)19/h7-9H,4-6H2,1-3H3,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | NODLPEUEJMHKDB-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.21 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|