About 1'-(2-ethyl-4-methylanilino)-5'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one
1'-(2-ethyl-4-methylanilino)-5'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 139727144) has the molecular formula C30H25NO4
and a molecular weight of 463.53 g/mol. Its IUPAC name is 1'-(2-ethyl-4-methylanilino)-5'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
Molecular Properties
| Compound Name | 1'-(2-ethyl-4-methylanilino)-5'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| PubChem CID | 139727144 |
| Molecular Formula | C30H25NO4 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 1'-(2-ethyl-4-methylanilino)-5'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCc1cc(C)ccc1Nc1cccc2c1C1(OC(=O)c3ccccc31)c1cccc(OC)c1O2 |
| InChI | InChI=1S/C30H25NO4/c1-4-19-17-18(2)15-16-23(19)31-24-12-8-13-25-27(24)30(21-10-6-5-9-20(21)29(32)35-30)22-11-7-14-26(33-3)28(22)34-25/h5-17,31H,4H2,1-3H3 |
| InChIKey | ZQLPEAXHPJBGAA-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1'-(2-ethyl-4-methylanilino)-5'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(2-ethyl-4-methylanilino)-5'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one?
The IUPAC name of 1'-(2-ethyl-4-methylanilino)-5'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one (CID 139727144) is 1'-(2-ethyl-4-methylanilino)-5'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
What is the SMILES notation for 1'-(2-ethyl-4-methylanilino)-5'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one?
The canonical SMILES for 1'-(2-ethyl-4-methylanilino)-5'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one is CCc1cc(C)ccc1Nc1cccc2c1C1(OC(=O)c3ccccc31)c1cccc(OC)c1O2.
What is the InChIKey of 1'-(2-ethyl-4-methylanilino)-5'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one?
The InChIKey is ZQLPEAXHPJBGAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H25NO4/c1-4-19-17-18(2)15-16-23(19)31-24-12-8-13-25-27(24)30(21-10-6-5-9-20(21)29(32)35-30)22-11-7-14-26(33-3)28(22)34-25/h5-17,31H,4H2,1-3H3.
What are the key properties of 1'-(2-ethyl-4-methylanilino)-5'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one?
1'-(2-ethyl-4-methylanilino)-5'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one has a molecular weight of 463.53 g/mol, XLogP of 6.88, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(2-ethyl-4-methylanilino)-5'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one is sourced from PubChem (CID 139727144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).