C50H32BF24N3OS — CID 139728004
azidomethyl-phenacyl-(2,4,6-trimethylphenyl)sulfanium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide (PubChem CID 139728004) has the molecular formula C50H32BF24N3OS and a molecular weight of 1189.66 g/mol. Its IUPAC name is azidomethyl-phenacyl-(2,4,6-trimethylphenyl)sulfanium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide.
| Compound Name | azidomethyl-phenacyl-(2,4,6-trimethylphenyl)sulfanium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
|---|---|
| PubChem CID | 139728004 |
| Molecular Formula | C50H32BF24N3OS |
| Molecular Weight | 1189.66 g/mol |
| Exact Mass | 1189.20 |
| IUPAC Name | azidomethyl-phenacyl-(2,4,6-trimethylphenyl)sulfanium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
| SMILES | Cc1cc(C)c([S+](CN=[N+]=[N-])CC(=O)c2ccccc2)c(C)c1.FC(F)(F)c1cc([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H12BF24.C18H20N3OS/c34-25(35,36)13-1-14(26(37,38)39)6-21(5-13)33(22-7-15(27(40,41)42)2-16(8-22)28(43,44)45,23-9-17(29(46,47)48)3-18(10-23)30(49,50)51)24-11-19(31(52,53)54)4-20(12-24)32(55,56)57;1-13-9-14(2)18(15(3)10-13)23(12-20-21-19)11-17(22)16-7-5-4-6-8-16/h1-12H;4-10H,11-12H2,1-3H3/q-1;+1 |
| InChIKey | NYMDOKNPTQBURJ-UHFFFAOYSA-N |
| XLogP | 15.95 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1189.66 |
| LogP ≤ 5 | 15.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|