About 2-methyl-3,6-bis(oxiran-2-yl)oxane
2-methyl-3,6-bis(oxiran-2-yl)oxane (PubChem CID 139728258) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is 2-methyl-3,6-bis(oxiran-2-yl)oxane.
Molecular Properties
| Compound Name | 2-methyl-3,6-bis(oxiran-2-yl)oxane |
| PubChem CID | 139728258 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2-methyl-3,6-bis(oxiran-2-yl)oxane |
| SMILES | CC1OC(C2CO2)CCC1C1CO1 |
| InChI | InChI=1S/C10H16O3/c1-6-7(9-4-11-9)2-3-8(13-6)10-5-12-10/h6-10H,2-5H2,1H3 |
| InChIKey | NVTXAISDHWLOCU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3,6-bis(oxiran-2-yl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,6-bis(oxiran-2-yl)oxane?
The IUPAC name of 2-methyl-3,6-bis(oxiran-2-yl)oxane (CID 139728258) is 2-methyl-3,6-bis(oxiran-2-yl)oxane.
What is the SMILES notation for 2-methyl-3,6-bis(oxiran-2-yl)oxane?
The canonical SMILES for 2-methyl-3,6-bis(oxiran-2-yl)oxane is CC1OC(C2CO2)CCC1C1CO1.
What is the InChIKey of 2-methyl-3,6-bis(oxiran-2-yl)oxane?
The InChIKey is NVTXAISDHWLOCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-6-7(9-4-11-9)2-3-8(13-6)10-5-12-10/h6-10H,2-5H2,1H3.
What are the key properties of 2-methyl-3,6-bis(oxiran-2-yl)oxane?
2-methyl-3,6-bis(oxiran-2-yl)oxane has a molecular weight of 184.23 g/mol, XLogP of 0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,6-bis(oxiran-2-yl)oxane is sourced from PubChem (CID 139728258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).