C20H14N2O4S2 — CID 139728312
5-[[6-(1,3-benzoxazol-2-ylmethoxy)-1-benzothiophen-2-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 139728312) has the molecular formula C20H14N2O4S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 5-[[6-(1,3-benzoxazol-2-ylmethoxy)-1-benzothiophen-2-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[6-(1,3-benzoxazol-2-ylmethoxy)-1-benzothiophen-2-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139728312 |
| Molecular Formula | C20H14N2O4S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 5-[[6-(1,3-benzoxazol-2-ylmethoxy)-1-benzothiophen-2-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2cc3ccc(OCc4nc5ccccc5o4)cc3s2)S1 |
| InChI | InChI=1S/C20H14N2O4S2/c23-19-17(28-20(24)22-19)9-13-7-11-5-6-12(8-16(11)27-13)25-10-18-21-14-3-1-2-4-15(14)26-18/h1-8,17H,9-10H2,(H,22,23,24) |
| InChIKey | ROVMRXCRBYFRQS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|