C36H10BF20IO4 — CID 139729071
bis(5-acetylfuran-2-yl)iodanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139729071) has the molecular formula C36H10BF20IO4 and a molecular weight of 1024.15 g/mol. Its IUPAC name is bis(5-acetylfuran-2-yl)iodanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | bis(5-acetylfuran-2-yl)iodanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139729071 |
| Molecular Formula | C36H10BF20IO4 |
| Molecular Weight | 1024.15 g/mol |
| Exact Mass | 1023.94 |
| IUPAC Name | bis(5-acetylfuran-2-yl)iodanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CC(=O)c1ccc([I+]c2ccc(C(C)=O)o2)o1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C12H10IO4/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-7(14)9-3-5-11(16-9)13-12-6-4-10(17-12)8(2)15/h;3-6H,1-2H3/q-1;+1 |
| InChIKey | PQMLBRYJULQQEX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1024.15 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|