About (4-acetyloxyoxolan-3-yl) 2-(2-chloro-4-fluoro-5-isocyanatophenyl)sulfanylacetate
(4-acetyloxyoxolan-3-yl) 2-(2-chloro-4-fluoro-5-isocyanatophenyl)sulfanylacetate (PubChem CID 139729458) has the molecular formula C15H13ClFNO6S
and a molecular weight of 389.79 g/mol. Its IUPAC name is (4-acetyloxyoxolan-3-yl) 2-(2-chloro-4-fluoro-5-isocyanatophenyl)sulfanylacetate.
Molecular Properties
| Compound Name | (4-acetyloxyoxolan-3-yl) 2-(2-chloro-4-fluoro-5-isocyanatophenyl)sulfanylacetate |
| PubChem CID | 139729458 |
| Molecular Formula | C15H13ClFNO6S |
| Molecular Weight | 389.79 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | (4-acetyloxyoxolan-3-yl) 2-(2-chloro-4-fluoro-5-isocyanatophenyl)sulfanylacetate |
| SMILES | CC(=O)OC1COCC1OC(=O)CSc1cc(N=C=O)c(F)cc1Cl |
| InChI | InChI=1S/C15H13ClFNO6S/c1-8(20)23-12-4-22-5-13(12)24-15(21)6-25-14-3-11(18-7-19)10(17)2-9(14)16/h2-3,12-13H,4-6H2,1H3 |
| InChIKey | GFJFNMBRSRMRKI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.79 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze (4-acetyloxyoxolan-3-yl) 2-(2-chloro-4-fluoro-5-isocyanatophenyl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetyloxyoxolan-3-yl) 2-(2-chloro-4-fluoro-5-isocyanatophenyl)sulfanylacetate?
The IUPAC name of (4-acetyloxyoxolan-3-yl) 2-(2-chloro-4-fluoro-5-isocyanatophenyl)sulfanylacetate (CID 139729458) is (4-acetyloxyoxolan-3-yl) 2-(2-chloro-4-fluoro-5-isocyanatophenyl)sulfanylacetate.
What is the SMILES notation for (4-acetyloxyoxolan-3-yl) 2-(2-chloro-4-fluoro-5-isocyanatophenyl)sulfanylacetate?
The canonical SMILES for (4-acetyloxyoxolan-3-yl) 2-(2-chloro-4-fluoro-5-isocyanatophenyl)sulfanylacetate is CC(=O)OC1COCC1OC(=O)CSc1cc(N=C=O)c(F)cc1Cl.
What is the InChIKey of (4-acetyloxyoxolan-3-yl) 2-(2-chloro-4-fluoro-5-isocyanatophenyl)sulfanylacetate?
The InChIKey is GFJFNMBRSRMRKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClFNO6S/c1-8(20)23-12-4-22-5-13(12)24-15(21)6-25-14-3-11(18-7-19)10(17)2-9(14)16/h2-3,12-13H,4-6H2,1H3.
What are the key properties of (4-acetyloxyoxolan-3-yl) 2-(2-chloro-4-fluoro-5-isocyanatophenyl)sulfanylacetate?
(4-acetyloxyoxolan-3-yl) 2-(2-chloro-4-fluoro-5-isocyanatophenyl)sulfanylacetate has a molecular weight of 389.79 g/mol, XLogP of 2.41, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetyloxyoxolan-3-yl) 2-(2-chloro-4-fluoro-5-isocyanatophenyl)sulfanylacetate is sourced from PubChem (CID 139729458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).