About sodium 2-amino-2-oxoethanolate
sodium 2-amino-2-oxoethanolate (PubChem CID 139729806) has the molecular formula C2H4NNaO2
and a molecular weight of 97.05 g/mol. Its IUPAC name is sodium 2-amino-2-oxoethanolate.
Molecular Properties
| Compound Name | sodium 2-amino-2-oxoethanolate |
| PubChem CID | 139729806 |
| Molecular Formula | C2H4NNaO2 |
| Molecular Weight | 97.05 g/mol |
| Exact Mass | 97.01 |
| IUPAC Name | sodium 2-amino-2-oxoethanolate |
| SMILES | NC(=O)C[O-].[Na+] |
| InChI | InChI=1S/C2H4NO2.Na/c3-2(5)1-4;/h1H2,(H2,3,5);/q-1;+1 |
| InChIKey | ATYJQXQMSCIOMH-UHFFFAOYSA-N |
| XLogP | -5.16 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.05 |
| LogP ≤ 5 | -5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium 2-amino-2-oxoethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-amino-2-oxoethanolate?
The IUPAC name of sodium 2-amino-2-oxoethanolate (CID 139729806) is sodium 2-amino-2-oxoethanolate.
What is the SMILES notation for sodium 2-amino-2-oxoethanolate?
The canonical SMILES for sodium 2-amino-2-oxoethanolate is NC(=O)C[O-].[Na+].
What is the InChIKey of sodium 2-amino-2-oxoethanolate?
The InChIKey is ATYJQXQMSCIOMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4NO2.Na/c3-2(5)1-4;/h1H2,(H2,3,5);/q-1;+1.
What are the key properties of sodium 2-amino-2-oxoethanolate?
sodium 2-amino-2-oxoethanolate has a molecular weight of 97.05 g/mol, XLogP of -5.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-amino-2-oxoethanolate is sourced from PubChem (CID 139729806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).