About [3-(4-azidobutylidene)-1,2-dihydroinden-5-yl]methanol
[3-(4-azidobutylidene)-1,2-dihydroinden-5-yl]methanol (PubChem CID 139730360) has the molecular formula C14H17N3O
and a molecular weight of 243.31 g/mol. Its IUPAC name is [3-(4-azidobutylidene)-1,2-dihydroinden-5-yl]methanol.
Molecular Properties
| Compound Name | [3-(4-azidobutylidene)-1,2-dihydroinden-5-yl]methanol |
| PubChem CID | 139730360 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | [3-(4-azidobutylidene)-1,2-dihydroinden-5-yl]methanol |
| SMILES | [N-]=[N+]=NCCCC=C1CCc2ccc(CO)cc21 |
| InChI | InChI=1S/C14H17N3O/c15-17-16-8-2-1-3-12-6-7-13-5-4-11(10-18)9-14(12)13/h3-5,9,18H,1-2,6-8,10H2 |
| InChIKey | NDWTZRVFYWOCBR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-azidobutylidene)-1,2-dihydroinden-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-azidobutylidene)-1,2-dihydroinden-5-yl]methanol?
The IUPAC name of [3-(4-azidobutylidene)-1,2-dihydroinden-5-yl]methanol (CID 139730360) is [3-(4-azidobutylidene)-1,2-dihydroinden-5-yl]methanol.
What is the SMILES notation for [3-(4-azidobutylidene)-1,2-dihydroinden-5-yl]methanol?
The canonical SMILES for [3-(4-azidobutylidene)-1,2-dihydroinden-5-yl]methanol is [N-]=[N+]=NCCCC=C1CCc2ccc(CO)cc21.
What is the InChIKey of [3-(4-azidobutylidene)-1,2-dihydroinden-5-yl]methanol?
The InChIKey is NDWTZRVFYWOCBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O/c15-17-16-8-2-1-3-12-6-7-13-5-4-11(10-18)9-14(12)13/h3-5,9,18H,1-2,6-8,10H2.
What are the key properties of [3-(4-azidobutylidene)-1,2-dihydroinden-5-yl]methanol?
[3-(4-azidobutylidene)-1,2-dihydroinden-5-yl]methanol has a molecular weight of 243.31 g/mol, XLogP of 3.60, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-azidobutylidene)-1,2-dihydroinden-5-yl]methanol is sourced from PubChem (CID 139730360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).