C41H20BF20NO — CID 139732652
1-(1-benzylpyridin-1-ium-2-yl)-2,2-dimethylpropan-1-one;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139732652) has the molecular formula C41H20BF20NO and a molecular weight of 933.39 g/mol. Its IUPAC name is 1-(1-benzylpyridin-1-ium-2-yl)-2,2-dimethylpropan-1-one;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-(1-benzylpyridin-1-ium-2-yl)-2,2-dimethylpropan-1-one;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139732652 |
| Molecular Formula | C41H20BF20NO |
| Molecular Weight | 933.39 g/mol |
| Exact Mass | 933.13 |
| IUPAC Name | 1-(1-benzylpyridin-1-ium-2-yl)-2,2-dimethylpropan-1-one;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CC(C)(C)C(=O)c1cccc[n+]1Cc1ccccc1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C17H20NO/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-17(2,3)16(19)15-11-7-8-12-18(15)13-14-9-5-4-6-10-14/h;4-12H,13H2,1-3H3/q-1;+1 |
| InChIKey | XCASCJHMUJDYRX-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.39 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|