About CID 139732752
CID 139732752 (PubChem CID 139732752) has the molecular formula C45H33BF12O4S
and a molecular weight of 908.61 g/mol.
Molecular Properties
| Compound Name | CID 139732752 |
| PubChem CID | 139732752 |
| Molecular Formula | C45H33BF12O4S |
| Molecular Weight | 908.61 g/mol |
| Exact Mass | 908.20 |
| IUPAC Name | — |
| SMILES | CC(=O)Oc1ccc([S+](C)(=O)CC(=O)c2ccccc2)cc1.FC(F)(F)c1ccc([B-](c2ccc(C(F)(F)F)cc2)(c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H16BF12.C17H17O4S/c30-25(31,32)17-1-9-21(10-2-17)29(22-11-3-18(4-12-22)26(33,34)35,23-13-5-19(6-14-23)27(36,37)38)24-15-7-20(8-16-24)28(39,40)41;1-13(18)21-15-8-10-16(11-9-15)22(2,20)12-17(19)14-6-4-3-5-7-14/h1-16H;3-11H,12H2,1-2H3/q-1;+1 |
| InChIKey | YMUIGCDHVXJSBX-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 908.61 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze CID 139732752 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139732752?
The IUPAC name of CID 139732752 (CID 139732752) is not available.
What is the SMILES notation for CID 139732752?
The canonical SMILES for CID 139732752 is CC(=O)Oc1ccc([S+](C)(=O)CC(=O)c2ccccc2)cc1.FC(F)(F)c1ccc([B-](c2ccc(C(F)(F)F)cc2)(c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)cc2)cc1.
What is the InChIKey of CID 139732752?
The InChIKey is YMUIGCDHVXJSBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H16BF12.C17H17O4S/c30-25(31,32)17-1-9-21(10-2-17)29(22-11-3-18(4-12-22)26(33,34)35,23-13-5-19(6-14-23)27(36,37)38)24-15-7-20(8-16-24)28(39,40)41;1-13(18)21-15-8-10-16(11-9-15)22(2,20)12-17(19)14-6-4-3-5-7-14/h1-16H;3-11H,12H2,1-2H3/q-1;+1.
What are the key properties of CID 139732752?
CID 139732752 has a molecular weight of 908.61 g/mol, XLogP of 10.12, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139732752 is sourced from PubChem (CID 139732752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).