About CID 139733468
CID 139733468 (PubChem CID 139733468) has the molecular formula C40H17BF20O3S
and a molecular weight of 968.41 g/mol.
Molecular Properties
| Compound Name | CID 139733468 |
| PubChem CID | 139733468 |
| Molecular Formula | C40H17BF20O3S |
| Molecular Weight | 968.41 g/mol |
| Exact Mass | 968.07 |
| IUPAC Name | — |
| SMILES | CC(=O)Oc1ccc(C[S+](C)(=O)c2ccccc2)cc1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C16H17O3S/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-13(17)19-15-10-8-14(9-11-15)12-20(2,18)16-6-4-3-5-7-16/h;3-11H,12H2,1-2H3/q-1;+1 |
| InChIKey | NGDIEVKYYLPZJB-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 968.41 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze CID 139733468 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139733468?
The IUPAC name of CID 139733468 (CID 139733468) is not available.
What is the SMILES notation for CID 139733468?
The canonical SMILES for CID 139733468 is CC(=O)Oc1ccc(C[S+](C)(=O)c2ccccc2)cc1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.
What is the InChIKey of CID 139733468?
The InChIKey is NGDIEVKYYLPZJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24BF20.C16H17O3S/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-13(17)19-15-10-8-14(9-11-15)12-20(2,18)16-6-4-3-5-7-16/h;3-11H,12H2,1-2H3/q-1;+1.
What are the key properties of CID 139733468?
CID 139733468 has a molecular weight of 968.41 g/mol, XLogP of 9.15, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139733468 is sourced from PubChem (CID 139733468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).