C31H41N3O3 — CID 139733972
3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-[(2-ethylimidazol-1-yl)methyl]phenyl]octanamide (PubChem CID 139733972) has the molecular formula C31H41N3O3 and a molecular weight of 503.69 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-[(2-ethylimidazol-1-yl)methyl]phenyl]octanamide.
| Compound Name | 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-[(2-ethylimidazol-1-yl)methyl]phenyl]octanamide |
|---|---|
| PubChem CID | 139733972 |
| Molecular Formula | C31H41N3O3 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-[(2-ethylimidazol-1-yl)methyl]phenyl]octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(Cn2ccnc2CC)ccc1C(C)(C)C)c1cccc2c1OCO2 |
| InChI | InChI=1S/C31H41N3O3/c1-6-8-9-11-23(24-12-10-13-27-30(24)37-21-36-27)19-29(35)33-26-18-22(14-15-25(26)31(3,4)5)20-34-17-16-32-28(34)7-2/h10,12-18,23H,6-9,11,19-21H2,1-5H3,(H,33,35) |
| InChIKey | UGVIGPHMHBTLPO-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|