C31H41N3O4 — CID 139734011
3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(2-imidazol-1-ylethoxymethyl)phenyl]octanamide (PubChem CID 139734011) has the molecular formula C31H41N3O4 and a molecular weight of 519.69 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(2-imidazol-1-ylethoxymethyl)phenyl]octanamide.
| Compound Name | 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(2-imidazol-1-ylethoxymethyl)phenyl]octanamide |
|---|---|
| PubChem CID | 139734011 |
| Molecular Formula | C31H41N3O4 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | 3-(1,3-benzodioxol-4-yl)-N-[2-tert-butyl-5-(2-imidazol-1-ylethoxymethyl)phenyl]octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(COCCn2ccnc2)ccc1C(C)(C)C)c1cccc2c1OCO2 |
| InChI | InChI=1S/C31H41N3O4/c1-5-6-7-9-24(25-10-8-11-28-30(25)38-22-37-28)19-29(35)33-27-18-23(12-13-26(27)31(2,3)4)20-36-17-16-34-15-14-32-21-34/h8,10-15,18,21,24H,5-7,9,16-17,19-20,22H2,1-4H3,(H,33,35) |
| InChIKey | FYCJMDVGHDABNS-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|