About [3,5-bis(trifluoromethyl)phenyl] bis[trimethyl(phenacyl)-λ5-phosphanyl] borate
[3,5-bis(trifluoromethyl)phenyl] bis[trimethyl(phenacyl)-λ5-phosphanyl] borate (PubChem CID 139734211) has the molecular formula C30H35BF6O5P2
and a molecular weight of 662.35 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] bis[trimethyl(phenacyl)-λ5-phosphanyl] borate.
Molecular Properties
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] bis[trimethyl(phenacyl)-λ5-phosphanyl] borate |
| PubChem CID | 139734211 |
| Molecular Formula | C30H35BF6O5P2 |
| Molecular Weight | 662.35 g/mol |
| Exact Mass | 662.20 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] bis[trimethyl(phenacyl)-λ5-phosphanyl] borate |
| SMILES | CP(C)(C)(CC(=O)c1ccccc1)OB(Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1)OP(C)(C)(C)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H35BF6O5P2/c1-43(2,3,20-27(38)22-13-9-7-10-14-22)41-31(42-44(4,5,6)21-28(39)23-15-11-8-12-16-23)40-26-18-24(29(32,33)34)17-25(19-26)30(35,36)37/h7-19H,20-21H2,1-6H3 |
| InChIKey | COUAWCJEQPJZNI-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 662.35 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3,5-bis(trifluoromethyl)phenyl] bis[trimethyl(phenacyl)-λ5-phosphanyl] borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(trifluoromethyl)phenyl] bis[trimethyl(phenacyl)-λ5-phosphanyl] borate?
The IUPAC name of [3,5-bis(trifluoromethyl)phenyl] bis[trimethyl(phenacyl)-λ5-phosphanyl] borate (CID 139734211) is [3,5-bis(trifluoromethyl)phenyl] bis[trimethyl(phenacyl)-λ5-phosphanyl] borate.
What is the SMILES notation for [3,5-bis(trifluoromethyl)phenyl] bis[trimethyl(phenacyl)-λ5-phosphanyl] borate?
The canonical SMILES for [3,5-bis(trifluoromethyl)phenyl] bis[trimethyl(phenacyl)-λ5-phosphanyl] borate is CP(C)(C)(CC(=O)c1ccccc1)OB(Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1)OP(C)(C)(C)CC(=O)c1ccccc1.
What is the InChIKey of [3,5-bis(trifluoromethyl)phenyl] bis[trimethyl(phenacyl)-λ5-phosphanyl] borate?
The InChIKey is COUAWCJEQPJZNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H35BF6O5P2/c1-43(2,3,20-27(38)22-13-9-7-10-14-22)41-31(42-44(4,5,6)21-28(39)23-15-11-8-12-16-23)40-26-18-24(29(32,33)34)17-25(19-26)30(35,36)37/h7-19H,20-21H2,1-6H3.
What are the key properties of [3,5-bis(trifluoromethyl)phenyl] bis[trimethyl(phenacyl)-λ5-phosphanyl] borate?
[3,5-bis(trifluoromethyl)phenyl] bis[trimethyl(phenacyl)-λ5-phosphanyl] borate has a molecular weight of 662.35 g/mol, XLogP of 8.60, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(trifluoromethyl)phenyl] bis[trimethyl(phenacyl)-λ5-phosphanyl] borate is sourced from PubChem (CID 139734211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).