C60H41BBr6F6O5P2 — CID 139734260
[3,5-bis(trifluoromethyl)phenyl] bis[[2-oxo-2-(2,4,6-tribromophenyl)ethyl]-triphenyl-λ5-phosphanyl] borate (PubChem CID 139734260) has the molecular formula C60H41BBr6F6O5P2 and a molecular weight of 1508.15 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] bis[[2-oxo-2-(2,4,6-tribromophenyl)ethyl]-triphenyl-λ5-phosphanyl] borate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] bis[[2-oxo-2-(2,4,6-tribromophenyl)ethyl]-triphenyl-λ5-phosphanyl] borate |
|---|---|
| PubChem CID | 139734260 |
| Molecular Formula | C60H41BBr6F6O5P2 |
| Molecular Weight | 1508.15 g/mol |
| Exact Mass | 1501.75 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] bis[[2-oxo-2-(2,4,6-tribromophenyl)ethyl]-triphenyl-λ5-phosphanyl] borate |
| SMILES | O=C(CP(OB(Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1)OP(CC(=O)c1c(Br)cc(Br)cc1Br)(c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1)c1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C60H41BBr6F6O5P2/c62-42-34-51(64)57(52(65)35-42)55(74)38-79(45-19-7-1-8-20-45,46-21-9-2-10-22-46,47-23-11-3-12-24-47)77-61(76-44-32-40(59(68,69)70)31-41(33-44)60(71,72)73)78-80(48-25-13-4-14-26-48,49-27-15-5-16-28-49,50-29-17-6-18-30-50)39-56(75)58-53(66)36-43(63)37-54(58)67/h1-37H,38-39H2 |
| InChIKey | DUTMCJHEVGDWKR-UHFFFAOYSA-N |
| XLogP | 17.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1508.15 |
| LogP ≤ 5 | 17.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|