About [3,5-bis(trifluoromethyl)phenyl] bis[tris(hydroxymethyl)-phenacyl-λ5-phosphanyl] borate
[3,5-bis(trifluoromethyl)phenyl] bis[tris(hydroxymethyl)-phenacyl-λ5-phosphanyl] borate (PubChem CID 139734271) has the molecular formula C30H35BF6O11P2
and a molecular weight of 758.35 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] bis[tris(hydroxymethyl)-phenacyl-λ5-phosphanyl] borate.
Molecular Properties
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] bis[tris(hydroxymethyl)-phenacyl-λ5-phosphanyl] borate |
| PubChem CID | 139734271 |
| Molecular Formula | C30H35BF6O11P2 |
| Molecular Weight | 758.35 g/mol |
| Exact Mass | 758.17 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] bis[tris(hydroxymethyl)-phenacyl-λ5-phosphanyl] borate |
| SMILES | O=C(CP(CO)(CO)(CO)OB(Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1)OP(CO)(CO)(CO)CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H35BF6O11P2/c32-29(33,34)24-11-25(30(35,36)37)13-26(12-24)46-31(47-49(16-38,17-39,18-40)14-27(44)22-7-3-1-4-8-22)48-50(19-41,20-42,21-43)15-28(45)23-9-5-2-6-10-23/h1-13,38-43H,14-21H2 |
| InChIKey | YVGUTXPVKURGLB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 183.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 758.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3,5-bis(trifluoromethyl)phenyl] bis[tris(hydroxymethyl)-phenacyl-λ5-phosphanyl] borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(trifluoromethyl)phenyl] bis[tris(hydroxymethyl)-phenacyl-λ5-phosphanyl] borate?
The IUPAC name of [3,5-bis(trifluoromethyl)phenyl] bis[tris(hydroxymethyl)-phenacyl-λ5-phosphanyl] borate (CID 139734271) is [3,5-bis(trifluoromethyl)phenyl] bis[tris(hydroxymethyl)-phenacyl-λ5-phosphanyl] borate.
What is the SMILES notation for [3,5-bis(trifluoromethyl)phenyl] bis[tris(hydroxymethyl)-phenacyl-λ5-phosphanyl] borate?
The canonical SMILES for [3,5-bis(trifluoromethyl)phenyl] bis[tris(hydroxymethyl)-phenacyl-λ5-phosphanyl] borate is O=C(CP(CO)(CO)(CO)OB(Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1)OP(CO)(CO)(CO)CC(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of [3,5-bis(trifluoromethyl)phenyl] bis[tris(hydroxymethyl)-phenacyl-λ5-phosphanyl] borate?
The InChIKey is YVGUTXPVKURGLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H35BF6O11P2/c32-29(33,34)24-11-25(30(35,36)37)13-26(12-24)46-31(47-49(16-38,17-39,18-40)14-27(44)22-7-3-1-4-8-22)48-50(19-41,20-42,21-43)15-28(45)23-9-5-2-6-10-23/h1-13,38-43H,14-21H2.
What are the key properties of [3,5-bis(trifluoromethyl)phenyl] bis[tris(hydroxymethyl)-phenacyl-λ5-phosphanyl] borate?
[3,5-bis(trifluoromethyl)phenyl] bis[tris(hydroxymethyl)-phenacyl-λ5-phosphanyl] borate has a molecular weight of 758.35 g/mol, XLogP of 4.52, 18 rotatable bonds, 6 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(trifluoromethyl)phenyl] bis[tris(hydroxymethyl)-phenacyl-λ5-phosphanyl] borate is sourced from PubChem (CID 139734271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).