About 1-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrazin-1-ium
1-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrazin-1-ium (PubChem CID 139736152) has the molecular formula C9H7F6N2+
and a molecular weight of 257.16 g/mol. Its IUPAC name is 1-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrazin-1-ium.
Molecular Properties
| Compound Name | 1-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrazin-1-ium |
| PubChem CID | 139736152 |
| Molecular Formula | C9H7F6N2+ |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 1-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrazin-1-ium |
| SMILES | FC(F)(F)C(=CC[n+]1ccncc1)C(F)(F)F |
| InChI | InChI=1S/C9H7F6N2/c10-8(11,12)7(9(13,14)15)1-4-17-5-2-16-3-6-17/h1-3,5-6H,4H2/q+1 |
| InChIKey | HHIKCEXDUGAKTI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrazin-1-ium?
The IUPAC name of 1-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrazin-1-ium (CID 139736152) is 1-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrazin-1-ium.
What is the SMILES notation for 1-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrazin-1-ium?
The canonical SMILES for 1-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrazin-1-ium is FC(F)(F)C(=CC[n+]1ccncc1)C(F)(F)F.
What is the InChIKey of 1-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrazin-1-ium?
The InChIKey is HHIKCEXDUGAKTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F6N2/c10-8(11,12)7(9(13,14)15)1-4-17-5-2-16-3-6-17/h1-3,5-6H,4H2/q+1.
What are the key properties of 1-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrazin-1-ium?
1-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrazin-1-ium has a molecular weight of 257.16 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4,4,4-trifluoro-3-(trifluoromethyl)but-2-enyl]pyrazin-1-ium is sourced from PubChem (CID 139736152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).