C45H23BF24N2O4 — CID 139737134
1-benzylpyrazin-1-ium-2,3-dicarboxylic acid;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide (PubChem CID 139737134) has the molecular formula C45H23BF24N2O4 and a molecular weight of 1122.45 g/mol. Its IUPAC name is 1-benzylpyrazin-1-ium-2,3-dicarboxylic acid;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide.
| Compound Name | 1-benzylpyrazin-1-ium-2,3-dicarboxylic acid;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
|---|---|
| PubChem CID | 139737134 |
| Molecular Formula | C45H23BF24N2O4 |
| Molecular Weight | 1122.45 g/mol |
| Exact Mass | 1122.14 |
| IUPAC Name | 1-benzylpyrazin-1-ium-2,3-dicarboxylic acid;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
| SMILES | FC(F)(F)c1cc([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1.O=C(O)c1ncc[n+](Cc2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C32H12BF24.C13H10N2O4/c34-25(35,36)13-1-14(26(37,38)39)6-21(5-13)33(22-7-15(27(40,41)42)2-16(8-22)28(43,44)45,23-9-17(29(46,47)48)3-18(10-23)30(49,50)51)24-11-19(31(52,53)54)4-20(12-24)32(55,56)57;16-12(17)10-11(13(18)19)15(7-6-14-10)8-9-4-2-1-3-5-9/h1-12H;1-7H,8H2,(H-,16,17,18,19)/q-1;/p+1 |
| InChIKey | FCKTUWWILXKKTH-UHFFFAOYSA-O |
| XLogP | 12.03 |
| TPSA | 91.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1122.45 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|