C42H17BF20N2 — CID 139737486
1-benzyl-2-(3-methylphenyl)pyrazin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139737486) has the molecular formula C42H17BF20N2 and a molecular weight of 940.38 g/mol. Its IUPAC name is 1-benzyl-2-(3-methylphenyl)pyrazin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-benzyl-2-(3-methylphenyl)pyrazin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139737486 |
| Molecular Formula | C42H17BF20N2 |
| Molecular Weight | 940.38 g/mol |
| Exact Mass | 940.12 |
| IUPAC Name | 1-benzyl-2-(3-methylphenyl)pyrazin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Cc1cccc(-c2cncc[n+]2Cc2ccccc2)c1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C18H17N2/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-15-6-5-9-17(12-15)18-13-19-10-11-20(18)14-16-7-3-2-4-8-16/h;2-13H,14H2,1H3/q-1;+1 |
| InChIKey | WOBNMLJKGSIRJB-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.38 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|