C48H31BF24N2 — CID 139737930
1-benzyl-2-cyclopentylpyrazin-1-ium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide (PubChem CID 139737930) has the molecular formula C48H31BF24N2 and a molecular weight of 1102.55 g/mol. Its IUPAC name is 1-benzyl-2-cyclopentylpyrazin-1-ium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide.
| Compound Name | 1-benzyl-2-cyclopentylpyrazin-1-ium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
|---|---|
| PubChem CID | 139737930 |
| Molecular Formula | C48H31BF24N2 |
| Molecular Weight | 1102.55 g/mol |
| Exact Mass | 1102.22 |
| IUPAC Name | 1-benzyl-2-cyclopentylpyrazin-1-ium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
| SMILES | FC(F)(F)c1cc([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1.c1ccc(C[n+]2ccncc2C2CCCC2)cc1 |
| InChI | InChI=1S/C32H12BF24.C16H19N2/c34-25(35,36)13-1-14(26(37,38)39)6-21(5-13)33(22-7-15(27(40,41)42)2-16(8-22)28(43,44)45,23-9-17(29(46,47)48)3-18(10-23)30(49,50)51)24-11-19(31(52,53)54)4-20(12-24)32(55,56)57;1-2-6-14(7-3-1)13-18-11-10-17-12-16(18)15-8-4-5-9-15/h1-12H;1-3,6-7,10-12,15H,4-5,8-9,13H2/q-1;+1 |
| InChIKey | VOQWEFSLICKKRI-UHFFFAOYSA-N |
| XLogP | 14.29 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1102.55 |
| LogP ≤ 5 | 14.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|