About 3-hexadecyloxiren-2-ol
3-hexadecyloxiren-2-ol (PubChem CID 139738806) has the molecular formula C18H34O2
and a molecular weight of 282.47 g/mol. Its IUPAC name is 3-hexadecyloxiren-2-ol.
Molecular Properties
| Compound Name | 3-hexadecyloxiren-2-ol |
| PubChem CID | 139738806 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | 3-hexadecyloxiren-2-ol |
| SMILES | CCCCCCCCCCCCCCCCC1=C(O)O1 |
| InChI | InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20-17/h19H,2-16H2,1H3 |
| InChIKey | FANWHUZPGXJMSB-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hexadecyloxiren-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexadecyloxiren-2-ol?
The IUPAC name of 3-hexadecyloxiren-2-ol (CID 139738806) is 3-hexadecyloxiren-2-ol.
What is the SMILES notation for 3-hexadecyloxiren-2-ol?
The canonical SMILES for 3-hexadecyloxiren-2-ol is CCCCCCCCCCCCCCCCC1=C(O)O1.
What is the InChIKey of 3-hexadecyloxiren-2-ol?
The InChIKey is FANWHUZPGXJMSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20-17/h19H,2-16H2,1H3.
What are the key properties of 3-hexadecyloxiren-2-ol?
3-hexadecyloxiren-2-ol has a molecular weight of 282.47 g/mol, XLogP of 6.62, 15 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexadecyloxiren-2-ol is sourced from PubChem (CID 139738806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).