C42H14BBr2F20N — CID 139738970
2-benzyl-1-(2,2-dibromoethenyl)isoquinolin-2-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139738970) has the molecular formula C42H14BBr2F20N and a molecular weight of 1083.16 g/mol. Its IUPAC name is 2-benzyl-1-(2,2-dibromoethenyl)isoquinolin-2-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 2-benzyl-1-(2,2-dibromoethenyl)isoquinolin-2-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139738970 |
| Molecular Formula | C42H14BBr2F20N |
| Molecular Weight | 1083.16 g/mol |
| Exact Mass | 1080.93 |
| IUPAC Name | 2-benzyl-1-(2,2-dibromoethenyl)isoquinolin-2-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | BrC(Br)=Cc1c2ccccc2cc[n+]1Cc1ccccc1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C18H14Br2N/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;19-18(20)12-17-16-9-5-4-8-15(16)10-11-21(17)13-14-6-2-1-3-7-14/h;1-12H,13H2/q-1;+1 |
| InChIKey | NHGFUAHVQNUZPE-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1083.16 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|