C40H13BF20N2O2 — CID 139739394
2-benzyl-8-nitroisoquinolin-2-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139739394) has the molecular formula C40H13BF20N2O2 and a molecular weight of 944.33 g/mol. Its IUPAC name is 2-benzyl-8-nitroisoquinolin-2-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 2-benzyl-8-nitroisoquinolin-2-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139739394 |
| Molecular Formula | C40H13BF20N2O2 |
| Molecular Weight | 944.33 g/mol |
| Exact Mass | 944.08 |
| IUPAC Name | 2-benzyl-8-nitroisoquinolin-2-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=[N+]([O-])c1cccc2cc[n+](Cc3ccccc3)cc12 |
| InChI | InChI=1S/C24BF20.C16H13N2O2/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;19-18(20)16-8-4-7-14-9-10-17(12-15(14)16)11-13-5-2-1-3-6-13/h;1-10,12H,11H2/q-1;+1 |
| InChIKey | GSIUBGGGHQPDDD-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 47.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.33 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|