C25H22NO+ — CID 139740482
2-[1-(2,3-dimethylphenyl)isoquinolin-2-ium-2-yl]-1-phenylethanone (PubChem CID 139740482) has the molecular formula C25H22NO+ and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-[1-(2,3-dimethylphenyl)isoquinolin-2-ium-2-yl]-1-phenylethanone.
| Compound Name | 2-[1-(2,3-dimethylphenyl)isoquinolin-2-ium-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 139740482 |
| Molecular Formula | C25H22NO+ |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-[1-(2,3-dimethylphenyl)isoquinolin-2-ium-2-yl]-1-phenylethanone |
| SMILES | Cc1cccc(-c2c3ccccc3cc[n+]2CC(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C25H22NO/c1-18-9-8-14-22(19(18)2)25-23-13-7-6-10-20(23)15-16-26(25)17-24(27)21-11-4-3-5-12-21/h3-16H,17H2,1-2H3/q+1 |
| InChIKey | DFMSSUDJPVWAHE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|