C25H38ClNO7 — CID 139741061
3-chloro-4-(octoxycarbonylamino)-2-octoxycarbonyloxybenzoic acid (PubChem CID 139741061) has the molecular formula C25H38ClNO7 and a molecular weight of 500.03 g/mol. Its IUPAC name is 3-chloro-4-(octoxycarbonylamino)-2-octoxycarbonyloxybenzoic acid.
| Compound Name | 3-chloro-4-(octoxycarbonylamino)-2-octoxycarbonyloxybenzoic acid |
|---|---|
| PubChem CID | 139741061 |
| Molecular Formula | C25H38ClNO7 |
| Molecular Weight | 500.03 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 3-chloro-4-(octoxycarbonylamino)-2-octoxycarbonyloxybenzoic acid |
| SMILES | CCCCCCCCOC(=O)Nc1ccc(C(=O)O)c(OC(=O)OCCCCCCCC)c1Cl |
| InChI | InChI=1S/C25H38ClNO7/c1-3-5-7-9-11-13-17-32-24(30)27-20-16-15-19(23(28)29)22(21(20)26)34-25(31)33-18-14-12-10-8-6-4-2/h15-16H,3-14,17-18H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | QAWJQKCRXKBRMF-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.03 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|