C50H25BF24N2O — CID 139741558
1-phenacylquinolin-1-ium-5-carbonitrile;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide (PubChem CID 139741558) has the molecular formula C50H25BF24N2O and a molecular weight of 1136.53 g/mol. Its IUPAC name is 1-phenacylquinolin-1-ium-5-carbonitrile;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide.
| Compound Name | 1-phenacylquinolin-1-ium-5-carbonitrile;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
|---|---|
| PubChem CID | 139741558 |
| Molecular Formula | C50H25BF24N2O |
| Molecular Weight | 1136.53 g/mol |
| Exact Mass | 1136.17 |
| IUPAC Name | 1-phenacylquinolin-1-ium-5-carbonitrile;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
| SMILES | FC(F)(F)c1cc([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1.N#Cc1cccc2c1ccc[n+]2CC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H12BF24.C18H13N2O/c34-25(35,36)13-1-14(26(37,38)39)6-21(5-13)33(22-7-15(27(40,41)42)2-16(8-22)28(43,44)45,23-9-17(29(46,47)48)3-18(10-23)30(49,50)51)24-11-19(31(52,53)54)4-20(12-24)32(55,56)57;19-12-15-8-4-10-17-16(15)9-5-11-20(17)13-18(21)14-6-2-1-3-7-14/h1-12H;1-11H,13H2/q-1;+1 |
| InChIKey | NXXKMWUHBGRRQL-UHFFFAOYSA-N |
| XLogP | 14.10 |
| TPSA | 44.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1136.53 |
| LogP ≤ 5 | 14.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|