C40H13BBrF20N — CID 139742155
1-[(4-bromophenyl)methyl]quinolin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139742155) has the molecular formula C40H13BBrF20N and a molecular weight of 978.23 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]quinolin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-[(4-bromophenyl)methyl]quinolin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139742155 |
| Molecular Formula | C40H13BBrF20N |
| Molecular Weight | 978.23 g/mol |
| Exact Mass | 977.00 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]quinolin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Brc1ccc(C[n+]2cccc3ccccc32)cc1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C16H13BrN/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;17-15-9-7-13(8-10-15)12-18-11-3-5-14-4-1-2-6-16(14)18/h;1-11H,12H2/q-1;+1 |
| InChIKey | LOOZLOFACHWJEE-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.23 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|