C41H15BF20N2O — CID 139742760
1-benzylquinolin-1-ium-4-carboxamide;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139742760) has the molecular formula C41H15BF20N2O and a molecular weight of 942.36 g/mol. Its IUPAC name is 1-benzylquinolin-1-ium-4-carboxamide;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-benzylquinolin-1-ium-4-carboxamide;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139742760 |
| Molecular Formula | C41H15BF20N2O |
| Molecular Weight | 942.36 g/mol |
| Exact Mass | 942.10 |
| IUPAC Name | 1-benzylquinolin-1-ium-4-carboxamide;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.NC(=O)c1cc[n+](Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C24BF20.C17H14N2O/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;18-17(20)15-10-11-19(12-13-6-2-1-3-7-13)16-9-5-4-8-14(15)16/h;1-11H,12H2,(H-,18,20)/q-1;/p+1 |
| InChIKey | QQPWNOVAXCRSEN-UHFFFAOYSA-O |
| XLogP | 8.12 |
| TPSA | 46.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.36 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|