C37H50F6O4 — CID 139743577
decyl 2-[2-(3-decoxycarbonylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoate (PubChem CID 139743577) has the molecular formula C37H50F6O4 and a molecular weight of 672.79 g/mol. Its IUPAC name is decyl 2-[2-(3-decoxycarbonylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoate.
| Compound Name | decyl 2-[2-(3-decoxycarbonylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoate |
|---|---|
| PubChem CID | 139743577 |
| Molecular Formula | C37H50F6O4 |
| Molecular Weight | 672.79 g/mol |
| Exact Mass | 672.36 |
| IUPAC Name | decyl 2-[2-(3-decoxycarbonylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoate |
| SMILES | CCCCCCCCCCOC(=O)c1cccc(C(c2ccccc2C(=O)OCCCCCCCCCC)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C37H50F6O4/c1-3-5-7-9-11-13-15-19-26-46-33(44)29-22-21-23-30(28-29)35(36(38,39)40,37(41,42)43)32-25-18-17-24-31(32)34(45)47-27-20-16-14-12-10-8-6-4-2/h17-18,21-25,28H,3-16,19-20,26-27H2,1-2H3 |
| InChIKey | IDQZGTCSUMDLRX-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.79 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|