C33H42F6O4 — CID 139743578
octyl 2-[1,1,1,3,3,3-hexafluoro-2-(3-octoxycarbonylphenyl)propan-2-yl]benzoate (PubChem CID 139743578) has the molecular formula C33H42F6O4 and a molecular weight of 616.68 g/mol. Its IUPAC name is octyl 2-[1,1,1,3,3,3-hexafluoro-2-(3-octoxycarbonylphenyl)propan-2-yl]benzoate.
| Compound Name | octyl 2-[1,1,1,3,3,3-hexafluoro-2-(3-octoxycarbonylphenyl)propan-2-yl]benzoate |
|---|---|
| PubChem CID | 139743578 |
| Molecular Formula | C33H42F6O4 |
| Molecular Weight | 616.68 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | octyl 2-[1,1,1,3,3,3-hexafluoro-2-(3-octoxycarbonylphenyl)propan-2-yl]benzoate |
| SMILES | CCCCCCCCOC(=O)c1cccc(C(c2ccccc2C(=O)OCCCCCCCC)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C33H42F6O4/c1-3-5-7-9-11-15-22-42-29(40)25-18-17-19-26(24-25)31(32(34,35)36,33(37,38)39)28-21-14-13-20-27(28)30(41)43-23-16-12-10-8-6-4-2/h13-14,17-21,24H,3-12,15-16,22-23H2,1-2H3 |
| InChIKey | JHWGKPZCHXIPNF-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.68 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|