C35H46F6O4 — CID 139743599
nonyl 2-[1,1,1,3,3,3-hexafluoro-2-(3-nonoxycarbonylphenyl)propan-2-yl]benzoate (PubChem CID 139743599) has the molecular formula C35H46F6O4 and a molecular weight of 644.74 g/mol. Its IUPAC name is nonyl 2-[1,1,1,3,3,3-hexafluoro-2-(3-nonoxycarbonylphenyl)propan-2-yl]benzoate.
| Compound Name | nonyl 2-[1,1,1,3,3,3-hexafluoro-2-(3-nonoxycarbonylphenyl)propan-2-yl]benzoate |
|---|---|
| PubChem CID | 139743599 |
| Molecular Formula | C35H46F6O4 |
| Molecular Weight | 644.74 g/mol |
| Exact Mass | 644.33 |
| IUPAC Name | nonyl 2-[1,1,1,3,3,3-hexafluoro-2-(3-nonoxycarbonylphenyl)propan-2-yl]benzoate |
| SMILES | CCCCCCCCCOC(=O)c1cccc(C(c2ccccc2C(=O)OCCCCCCCCC)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C35H46F6O4/c1-3-5-7-9-11-13-17-24-44-31(42)27-20-19-21-28(26-27)33(34(36,37)38,35(39,40)41)30-23-16-15-22-29(30)32(43)45-25-18-14-12-10-8-6-4-2/h15-16,19-23,26H,3-14,17-18,24-25H2,1-2H3 |
| InChIKey | MVYYIUBNFZLCKN-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.74 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|