C10H18N2O5 — CID 139743955
(2S)-2-[[(2S)-3-carboxy-2-[deuterio(methyl)amino]propanoyl]amino]-3-methylbutanoic acid (PubChem CID 139743955) has the molecular formula C10H18N2O5 and a molecular weight of 247.27 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-carboxy-2-[deuterio(methyl)amino]propanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-carboxy-2-[deuterio(methyl)amino]propanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 139743955 |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | (2S)-2-[[(2S)-3-carboxy-2-[deuterio(methyl)amino]propanoyl]amino]-3-methylbutanoic acid |
| SMILES | [2H]N(C)[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C10H18N2O5/c1-5(2)8(10(16)17)12-9(15)6(11-3)4-7(13)14/h5-6,8,11H,4H2,1-3H3,(H,12,15)(H,13,14)(H,16,17)/t6-,8-/m0/s1/i/hD |
| InChIKey | NQLPQWAVBRUDDI-MSAZGCMASA-N |
| XLogP | -0.73 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |