C56H44BF24NS — CID 139744294
3-benzyl-7-decyl-1,3-benzothiazol-3-ium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide (PubChem CID 139744294) has the molecular formula C56H44BF24NS and a molecular weight of 1229.81 g/mol. Its IUPAC name is 3-benzyl-7-decyl-1,3-benzothiazol-3-ium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide.
| Compound Name | 3-benzyl-7-decyl-1,3-benzothiazol-3-ium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
|---|---|
| PubChem CID | 139744294 |
| Molecular Formula | C56H44BF24NS |
| Molecular Weight | 1229.81 g/mol |
| Exact Mass | 1229.29 |
| IUPAC Name | 3-benzyl-7-decyl-1,3-benzothiazol-3-ium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
| SMILES | CCCCCCCCCCc1cccc2c1sc[n+]2Cc1ccccc1.FC(F)(F)c1cc([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H12BF24.C24H32NS/c34-25(35,36)13-1-14(26(37,38)39)6-21(5-13)33(22-7-15(27(40,41)42)2-16(8-22)28(43,44)45,23-9-17(29(46,47)48)3-18(10-23)30(49,50)51)24-11-19(31(52,53)54)4-20(12-24)32(55,56)57;1-2-3-4-5-6-7-8-12-16-22-17-13-18-23-24(22)26-20-25(23)19-21-14-10-9-11-15-21/h1-12H;9-11,13-15,17-18,20H,2-8,12,16,19H2,1H3/q-1;+1 |
| InChIKey | RAICLTYUMBXTOW-UHFFFAOYSA-N |
| XLogP | 18.13 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1229.81 |
| LogP ≤ 5 | 18.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|