C18H26N2S — CID 139744647
N-(2-phenylpropyl)-5-propan-2-yl-4-propyl-1,3-thiazol-2-amine (PubChem CID 139744647) has the molecular formula C18H26N2S and a molecular weight of 302.49 g/mol. Its IUPAC name is N-(2-phenylpropyl)-5-propan-2-yl-4-propyl-1,3-thiazol-2-amine.
| Compound Name | N-(2-phenylpropyl)-5-propan-2-yl-4-propyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 139744647 |
| Molecular Formula | C18H26N2S |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | N-(2-phenylpropyl)-5-propan-2-yl-4-propyl-1,3-thiazol-2-amine |
| SMILES | CCCc1nc(NCC(C)c2ccccc2)sc1C(C)C |
| InChI | InChI=1S/C18H26N2S/c1-5-9-16-17(13(2)3)21-18(20-16)19-12-14(4)15-10-7-6-8-11-15/h6-8,10-11,13-14H,5,9,12H2,1-4H3,(H,19,20) |
| InChIKey | ZEEYOJYVWDMJKA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |