C48H44N2O6S — CID 139745445
[4-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2,3-bis[4-(pyridin-4-ylmethoxy)phenyl]phenyl] 2,4-dimethylbenzenesulfonate (PubChem CID 139745445) has the molecular formula C48H44N2O6S and a molecular weight of 776.95 g/mol. Its IUPAC name is [4-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2,3-bis[4-(pyridin-4-ylmethoxy)phenyl]phenyl] 2,4-dimethylbenzenesulfonate.
| Compound Name | [4-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2,3-bis[4-(pyridin-4-ylmethoxy)phenyl]phenyl] 2,4-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 139745445 |
| Molecular Formula | C48H44N2O6S |
| Molecular Weight | 776.95 g/mol |
| Exact Mass | 776.29 |
| IUPAC Name | [4-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2,3-bis[4-(pyridin-4-ylmethoxy)phenyl]phenyl] 2,4-dimethylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(-c3ccc(OC(C)(C)C)cc3)c(-c3ccc(OCc4ccncc4)cc3)c2-c2ccc(OCc3ccncc3)cc2)c(C)c1 |
| InChI | InChI=1S/C48H44N2O6S/c1-33-6-21-45(34(2)30-33)57(51,52)56-44-20-19-43(37-7-17-42(18-8-37)55-48(3,4)5)46(38-9-13-40(14-10-38)53-31-35-22-26-49-27-23-35)47(44)39-11-15-41(16-12-39)54-32-36-24-28-50-29-25-36/h6-30H,31-32H2,1-5H3 |
| InChIKey | OFTZEJDDBSSBRF-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.95 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|