About sodium;2-chloro-2,2-difluoroacetate;hydrate
sodium;2-chloro-2,2-difluoroacetate;hydrate (PubChem CID 139745825) has the molecular formula C2H2ClF2NaO3
and a molecular weight of 170.47 g/mol. Its IUPAC name is sodium;2-chloro-2,2-difluoroacetate;hydrate.
Molecular Properties
| Compound Name | sodium;2-chloro-2,2-difluoroacetate;hydrate |
| PubChem CID | 139745825 |
| Molecular Formula | C2H2ClF2NaO3 |
| Molecular Weight | 170.47 g/mol |
| Exact Mass | 169.96 |
| IUPAC Name | sodium;2-chloro-2,2-difluoroacetate;hydrate |
| SMILES | O.O=C([O-])C(F)(F)Cl.[Na+] |
| InChI | InChI=1S/C2HClF2O2.Na.H2O/c3-2(4,5)1(6)7;;/h(H,6,7);;1H2/q;+1;/p-1 |
| InChIKey | QFMFGFHYMIFLFH-UHFFFAOYSA-M |
| XLogP | -4.25 |
| TPSA | 71.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.47 |
| LogP ≤ 5 | -4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-chloro-2,2-difluoroacetate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-chloro-2,2-difluoroacetate;hydrate?
The IUPAC name of sodium;2-chloro-2,2-difluoroacetate;hydrate (CID 139745825) is sodium;2-chloro-2,2-difluoroacetate;hydrate.
What is the SMILES notation for sodium;2-chloro-2,2-difluoroacetate;hydrate?
The canonical SMILES for sodium;2-chloro-2,2-difluoroacetate;hydrate is O.O=C([O-])C(F)(F)Cl.[Na+].
What is the InChIKey of sodium;2-chloro-2,2-difluoroacetate;hydrate?
The InChIKey is QFMFGFHYMIFLFH-UHFFFAOYSA-M. The full InChI is InChI=1S/C2HClF2O2.Na.H2O/c3-2(4,5)1(6)7;;/h(H,6,7);;1H2/q;+1;/p-1.
What are the key properties of sodium;2-chloro-2,2-difluoroacetate;hydrate?
sodium;2-chloro-2,2-difluoroacetate;hydrate has a molecular weight of 170.47 g/mol, XLogP of -4.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-chloro-2,2-difluoroacetate;hydrate is sourced from PubChem (CID 139745825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).