C35H11BF21NS — CID 139745950
3-benzyl-4-(fluoromethyl)-1,3-thiazol-3-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139745950) has the molecular formula C35H11BF21NS and a molecular weight of 887.32 g/mol. Its IUPAC name is 3-benzyl-4-(fluoromethyl)-1,3-thiazol-3-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 3-benzyl-4-(fluoromethyl)-1,3-thiazol-3-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139745950 |
| Molecular Formula | C35H11BF21NS |
| Molecular Weight | 887.32 g/mol |
| Exact Mass | 887.04 |
| IUPAC Name | 3-benzyl-4-(fluoromethyl)-1,3-thiazol-3-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | FCc1csc[n+]1Cc1ccccc1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C11H11FNS/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;12-6-11-8-14-9-13(11)7-10-4-2-1-3-5-10/h;1-5,8-9H,6-7H2/q-1;+1 |
| InChIKey | OJDUVJHJRFCYMF-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.32 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|