C42H26BF20NS — CID 139745961
3-benzyl-5-octyl-1,3-thiazol-3-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139745961) has the molecular formula C42H26BF20NS and a molecular weight of 967.52 g/mol. Its IUPAC name is 3-benzyl-5-octyl-1,3-thiazol-3-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 3-benzyl-5-octyl-1,3-thiazol-3-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139745961 |
| Molecular Formula | C42H26BF20NS |
| Molecular Weight | 967.52 g/mol |
| Exact Mass | 967.16 |
| IUPAC Name | 3-benzyl-5-octyl-1,3-thiazol-3-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CCCCCCCCc1c[n+](Cc2ccccc2)cs1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C18H26NS/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-2-3-4-5-6-10-13-18-15-19(16-20-18)14-17-11-8-7-9-12-17/h;7-9,11-12,15-16H,2-6,10,13-14H2,1H3/q-1;+1 |
| InChIKey | SIPDHRYGQURFKM-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.52 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|