C24H18F4O2 — CID 139746551
2-[[4-[2,3,4,6-tetrafluoro-5-[4-(oxiran-2-ylmethyl)phenyl]phenyl]phenyl]methyl]oxirane (PubChem CID 139746551) has the molecular formula C24H18F4O2 and a molecular weight of 414.40 g/mol. Its IUPAC name is 2-[[4-[2,3,4,6-tetrafluoro-5-[4-(oxiran-2-ylmethyl)phenyl]phenyl]phenyl]methyl]oxirane.
| Compound Name | 2-[[4-[2,3,4,6-tetrafluoro-5-[4-(oxiran-2-ylmethyl)phenyl]phenyl]phenyl]methyl]oxirane |
|---|---|
| PubChem CID | 139746551 |
| Molecular Formula | C24H18F4O2 |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-[[4-[2,3,4,6-tetrafluoro-5-[4-(oxiran-2-ylmethyl)phenyl]phenyl]phenyl]methyl]oxirane |
| SMILES | Fc1c(F)c(-c2ccc(CC3CO3)cc2)c(F)c(-c2ccc(CC3CO3)cc2)c1F |
| InChI | InChI=1S/C24H18F4O2/c25-21-19(15-5-1-13(2-6-15)9-17-11-29-17)22(26)24(28)23(27)20(21)16-7-3-14(4-8-16)10-18-12-30-18/h1-8,17-18H,9-12H2 |
| InChIKey | LDUQZFCCFVIXNU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|