C12H24N6 — CID 139746596
1-N,1-N,1-N',1-N',1-N",1-N"-hexamethyl-3-(triazin-4-yl)propane-1,1,1-triamine (PubChem CID 139746596) has the molecular formula C12H24N6 and a molecular weight of 252.37 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',1-N",1-N"-hexamethyl-3-(triazin-4-yl)propane-1,1,1-triamine.
| Compound Name | 1-N,1-N,1-N',1-N',1-N",1-N"-hexamethyl-3-(triazin-4-yl)propane-1,1,1-triamine |
|---|---|
| PubChem CID | 139746596 |
| Molecular Formula | C12H24N6 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 1-N,1-N,1-N',1-N',1-N",1-N"-hexamethyl-3-(triazin-4-yl)propane-1,1,1-triamine |
| SMILES | CN(C)C(CCc1ccnnn1)(N(C)C)N(C)C |
| InChI | InChI=1S/C12H24N6/c1-16(2)12(17(3)4,18(5)6)9-7-11-8-10-13-15-14-11/h8,10H,7,9H2,1-6H3 |
| InChIKey | JTWNRIDVGLBGPR-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|