C22H26N6O5S2 — CID 139747018
[1-(dimethylaminodiazenyl)cyclohexa-2,4-dien-1-yl]sulfonyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate (PubChem CID 139747018) has the molecular formula C22H26N6O5S2 and a molecular weight of 518.62 g/mol. Its IUPAC name is [1-(dimethylaminodiazenyl)cyclohexa-2,4-dien-1-yl]sulfonyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate.
| Compound Name | [1-(dimethylaminodiazenyl)cyclohexa-2,4-dien-1-yl]sulfonyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 139747018 |
| Molecular Formula | C22H26N6O5S2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | [1-(dimethylaminodiazenyl)cyclohexa-2,4-dien-1-yl]sulfonyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate |
| SMILES | CN(C)N=NC1(S(=O)(=O)OS(=O)(=O)c2ccc(/N=N/c3ccc(N(C)C)cc3)cc2)C=CC=CC1 |
| InChI | InChI=1S/C22H26N6O5S2/c1-27(2)20-12-8-18(9-13-20)23-24-19-10-14-21(15-11-19)34(29,30)33-35(31,32)22(25-26-28(3)4)16-6-5-7-17-22/h5-16H,17H2,1-4H3/b24-23+,26-25? |
| InChIKey | CGRCXTCJXCCAEO-BYMSKALGSA-N |
| XLogP | 4.34 |
| TPSA | 133.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|