C21H21NO5 — CID 139747298
1-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-3,4-dihydro-2H-quinoline-2-carboxylic acid (PubChem CID 139747298) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 1-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-3,4-dihydro-2H-quinoline-2-carboxylic acid.
| Compound Name | 1-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-3,4-dihydro-2H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 139747298 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 1-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-3,4-dihydro-2H-quinoline-2-carboxylic acid |
| SMILES | COc1ccc(C=CC(=O)N2c3ccccc3CCC2C(=O)O)cc1OC |
| InChI | InChI=1S/C21H21NO5/c1-26-18-11-7-14(13-19(18)27-2)8-12-20(23)22-16-6-4-3-5-15(16)9-10-17(22)21(24)25/h3-8,11-13,17H,9-10H2,1-2H3,(H,24,25) |
| InChIKey | JWYUIYSQZATWFZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|