C40H14BF20N — CID 139748267
1-benzylisoquinolin-2-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139748267) has the molecular formula C40H14BF20N and a molecular weight of 899.33 g/mol. Its IUPAC name is 1-benzylisoquinolin-2-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-benzylisoquinolin-2-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139748267 |
| Molecular Formula | C40H14BF20N |
| Molecular Weight | 899.33 g/mol |
| Exact Mass | 899.09 |
| IUPAC Name | 1-benzylisoquinolin-2-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.c1ccc(Cc2[nH+]ccc3ccccc23)cc1 |
| InChI | InChI=1S/C24BF20.C16H13N/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-2-6-13(7-3-1)12-16-15-9-5-4-8-14(15)10-11-17-16/h;1-11H,12H2/q-1;/p+1 |
| InChIKey | NVVWTXYUCDLCNV-UHFFFAOYSA-O |
| XLogP | 9.09 |
| TPSA | 14.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.33 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|