About CID 139748342
CID 139748342 (PubChem CID 139748342) has the molecular formula C46H31BF24O4S
and a molecular weight of 1146.58 g/mol.
Molecular Properties
| Compound Name | CID 139748342 |
| PubChem CID | 139748342 |
| Molecular Formula | C46H31BF24O4S |
| Molecular Weight | 1146.58 g/mol |
| Exact Mass | 1146.17 |
| IUPAC Name | — |
| SMILES | CC(C)OC(=O)c1ccc(C(=O)C[S+](C)(C)=O)cc1.FC(F)(F)c1cc([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H12BF24.C14H19O4S/c34-25(35,36)13-1-14(26(37,38)39)6-21(5-13)33(22-7-15(27(40,41)42)2-16(8-22)28(43,44)45,23-9-17(29(46,47)48)3-18(10-23)30(49,50)51)24-11-19(31(52,53)54)4-20(12-24)32(55,56)57;1-10(2)18-14(16)12-7-5-11(6-8-12)13(15)9-19(3,4)17/h1-12H;5-8,10H,9H2,1-4H3/q-1;+1 |
| InChIKey | NQUPJZYDMWSCMX-UHFFFAOYSA-N |
| XLogP | 13.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 76 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1146.58 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 139748342 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139748342?
The IUPAC name of CID 139748342 (CID 139748342) is not available.
What is the SMILES notation for CID 139748342?
The canonical SMILES for CID 139748342 is CC(C)OC(=O)c1ccc(C(=O)C[S+](C)(C)=O)cc1.FC(F)(F)c1cc([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1.
What is the InChIKey of CID 139748342?
The InChIKey is NQUPJZYDMWSCMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H12BF24.C14H19O4S/c34-25(35,36)13-1-14(26(37,38)39)6-21(5-13)33(22-7-15(27(40,41)42)2-16(8-22)28(43,44)45,23-9-17(29(46,47)48)3-18(10-23)30(49,50)51)24-11-19(31(52,53)54)4-20(12-24)32(55,56)57;1-10(2)18-14(16)12-7-5-11(6-8-12)13(15)9-19(3,4)17/h1-12H;5-8,10H,9H2,1-4H3/q-1;+1.
What are the key properties of CID 139748342?
CID 139748342 has a molecular weight of 1146.58 g/mol, XLogP of 13.41, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139748342 is sourced from PubChem (CID 139748342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).